Products 73166-28-6
CAS 73166-28-6 appears in our catalog under these names: Effusol, Effusol/ 99.67% (existing batch purity), Effusol, 99.92% ,, 99.92% ,, Effusol, 99.83%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 1 mg, 5 mg, 10 mg.
5-ethenyl-1-methyl-9,10-dihydrophenanthrene-2,7-diol (CAS 73166-28-6) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: 5-ethenyl-1-methyl-9,10-dihydrophenanthrene-2,7-diol. InChIKey: GEXAPRXWKRZPCK-UHFFFAOYSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 5-ethenyl-1-methyl-9,10-dihydrophenanthrene-2,7-diol |
| InChIKey | GEXAPRXWKRZPCK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1CCC3=C2C(=CC(=C3)O)C=C)O |
Computed by PubChem (NCBI)
Synonyms:
EFFUSOL, 5-ethenyl-1-methyl-9,10-dihydrophenanthrene-2,7-diol, 2,7-Phenanthrenediol, 5-ethenyl-9,10-dihydro-1-methyl-, 1-methyl-5-vinyl-9,10-dihydrophenanthrene-2,7-diol, orb1219406, orb1297386, 5-Ethenyl-9,10-dihydro-1-methyl-2,7-phenanthrenediol, Effusol2,7-Phenanthrenediol, 5-ethenyl-9,10-dihydro-1-methyl-, 5-Ethenyl-9,10-dihydro-1-methyl-2,7-phenanthrenediol; NSC 371300;