cas: 1214361-41-7 — see every product listed under this CAS number, including other names
Ethyl 2,5-dibromo-4-pyridinecarboxylate (CAS 1214361-41-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632563-1G |
| cas | 1214361-41-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1351.63 Pln | |
| Fluorochem | 5g | 3918.43 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 2,5-dibromopyridine-4-carboxylate (CAS 1214361-41-7) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 2,5-dibromopyridine-4-carboxylate. InChIKey: MDCJXPCOMJFSHQ-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 2,5-dibromopyridine-4-carboxylate |
| InChIKey | MDCJXPCOMJFSHQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC=C1Br)Br |
Computed by PubChem (NCBI)