cas: 90050-70-7 — see every product listed under this CAS number, including other names
Ethyl 2,6-dibromoisonicotinate 97% (CAS 90050-70-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A505489-100mg |
| cas | 90050-70-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 704.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A505489 |
Ethyl 2,6-dibromopyridine-4-carboxylate (CAS 90050-70-7) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 2,6-dibromopyridine-4-carboxylate. InChIKey: NXSFXTCLCJXWDD-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 2,6-dibromopyridine-4-carboxylate |
| InChIKey | NXSFXTCLCJXWDD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1)Br)Br |
Computed by PubChem (NCBI)