cas: 258332-57-9 — see every product listed under this CAS number, including other names
Ethyl 2-((3-((tert-butoxycarbonyl)amino)propyl)amino)acetate, 95% (CAS 258332-57-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A421327-100mg |
| cas | 258332-57-9 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 809.81 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 1029.20 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 869.72 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate (CAS 258332-57-9) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate. InChIKey: IUZPINCLTDROJL-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O4 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate |
| InChIKey | IUZPINCLTDROJL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNCCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)