Products 1609406-96-3

CAS 1609406-96-3 is the registry number for ([1-(4-Morpholinyl)cyclohexyl]methyl)amine carbonic acid (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Carbonic acid;(1-morpholin-4-ylcyclohexyl)methanamine (CAS 1609406-96-3) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: carbonic acid;(1-morpholin-4-ylcyclohexyl)methanamine. InChIKey: XKMDPEQZPZAGDM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24N2O4
Molecular weight260.33 g/mol
IUPAC namecarbonic acid;(1-morpholin-4-ylcyclohexyl)methanamine
InChIKeyXKMDPEQZPZAGDM-UHFFFAOYSA-N
SMILESC1CCC(CC1)(CN)N2CCOCC2.C(=O)(O)O

Computed by PubChem (NCBI)