CAS 87694-52-8 appears in our catalog under these names: tert–Butyl N–((2S)–1–(methoxy(methyl)amino)–3–methyl–1–oxobutan–2–yl)carbamate, N-(tert-Butoxycarbonyl)-L-valine N'-methoxy-N'-methylamide, 97%, Boc-val-n(och3)ch3, 95%, 95%, Boc-L-valine N-methoxy-N-methyl amide, 97%, Boc-Val-N(OCH3)CH3, 95%. Offered by: GLPBio, Thermo Scientific (Acros), Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 100g.
Tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (CAS 87694-52-8) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: RRBFCGUIFHFYQK-VIFPVBQESA-N.
| Molecular formula | C12H24N2O4 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | RRBFCGUIFHFYQK-VIFPVBQESA-N |
| SMILES | CC(C)[C@@H](C(=O)N(C)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)