CAS 258332-57-9 appears in our catalog under these names: N-[3-(Boc-amino)propyl]glycine ethyl ester, 95%, N–(3–(tert–Butoxycarbonylamino)propyl)glycine Ethyl Ester, Ethyl 2-((3-((tert-butoxycarbonyl)amino)propyl)amino)acetate 95%, Ethyl 2-((3-((tert-butoxycarbonyl)amino)propyl)amino)acetate, 95%, 95%, N-[3-(TERT-BUTOXYCARBONYLAMINO)PROPYL]GLYCINE ETHYL ESTER, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 200mg, 100mg.
Ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate (CAS 258332-57-9) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate. InChIKey: IUZPINCLTDROJL-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O4 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate |
| InChIKey | IUZPINCLTDROJL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNCCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)