CAS 2387569-64-2 is the registry number for tert-Butyl (S)-(1-methylpyrrolidin-3-yl)carbamate acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Acetic acid;tert-butyl N-[(3S)-1-methylpyrrolidin-3-yl]carbamate (CAS 2387569-64-2) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: acetic acid;tert-butyl N-[(3S)-1-methylpyrrolidin-3-yl]carbamate. InChIKey: BMQSOSBBOFIIHQ-QRPNPIFTSA-N.
| Molecular formula | C12H24N2O4 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | acetic acid;tert-butyl N-[(3S)-1-methylpyrrolidin-3-yl]carbamate |
| InChIKey | BMQSOSBBOFIIHQ-QRPNPIFTSA-N |
| SMILES | CC(=O)O.CC(C)(C)OC(=O)N[C@H]1CCN(C1)C |
Computed by PubChem (NCBI)