Products 2387569-64-2

CAS 2387569-64-2 is the registry number for tert-Butyl (S)-(1-methylpyrrolidin-3-yl)carbamate acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Acetic acid;tert-butyl N-[(3S)-1-methylpyrrolidin-3-yl]carbamate (CAS 2387569-64-2) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: acetic acid;tert-butyl N-[(3S)-1-methylpyrrolidin-3-yl]carbamate. InChIKey: BMQSOSBBOFIIHQ-QRPNPIFTSA-N.

Identity
Molecular formulaC12H24N2O4
Molecular weight260.33 g/mol
IUPAC nameacetic acid;tert-butyl N-[(3S)-1-methylpyrrolidin-3-yl]carbamate
InChIKeyBMQSOSBBOFIIHQ-QRPNPIFTSA-N
SMILESCC(=O)O.CC(C)(C)OC(=O)N[C@H]1CCN(C1)C

Computed by PubChem (NCBI)