Products 1037073-41-8

CAS 1037073-41-8 is the registry number for tert-Butyl N-{1-[(3-methoxypropyl)carbamoyl]ethyl}carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]carbamate (CAS 1037073-41-8) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl N-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]carbamate. InChIKey: TYIJDOGDSSTJGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24N2O4
Molecular weight260.33 g/mol
IUPAC nametert-butyl N-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]carbamate
InChIKeyTYIJDOGDSSTJGJ-UHFFFAOYSA-N
SMILESCC(C(=O)NCCCOC)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)