CAS 190260-92-5 appears in our catalog under these names: tert-Butyl (R)-(1-(methoxy(methyl)amino)-3-methyl-1-oxobutan-2-yl)carbamate, 98%, (R)–tert–Butyl (1–((methoxymethyl)amino)–3–methyl–1–oxobutan–2–yl)carbamate. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (CAS 190260-92-5) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: RRBFCGUIFHFYQK-SECBINFHSA-N.
| Molecular formula | C12H24N2O4 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | RRBFCGUIFHFYQK-SECBINFHSA-N |
| SMILES | CC(C)[C@H](C(=O)N(C)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)