cas: 189512-01-4 — see every product listed under this CAS number, including other names
Ethyl 2-((tert-butoxycarbonyl)amino)thiazole-4-carboxylate 98% (CAS 189512-01-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A730627-250mg |
| cas | 189512-01-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 1093.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A730627 |
Ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate (CAS 189512-01-4) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate. InChIKey: CSKBQHOSNPFIQC-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate |
| InChIKey | CSKBQHOSNPFIQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)