CAS 150368-37-9 appears in our catalog under these names: Ethyl 2–amino–6–fluoro–3–nitrobenzoate, 2-Amino-6-fluoro-3-nitrobenzoic acid ethyl ester, Ethyl 2-amino-6-fluoro-3-nitrobenzoate, 97%, 97%, 2-Amino-6-fluoro-3-nitrobenzoic acid ethyl ester, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 2g, 5g, 100mg, 250mg, 10g.
Ethyl 2-amino-6-fluoro-3-nitrobenzoate (CAS 150368-37-9) is a chemical compound with the molecular formula C9H9FN2O4 and a molecular weight of 228.18 g/mol. IUPAC name: ethyl 2-amino-6-fluoro-3-nitrobenzoate. InChIKey: PJSMHOIXOKZIMX-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O4 |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | ethyl 2-amino-6-fluoro-3-nitrobenzoate |
| InChIKey | PJSMHOIXOKZIMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)