CAS 1365255-75-9 is the registry number for 4’,5’-Didehydro-2’,5’-dideoxy-2’-fluorouridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(3-fluoro-4-hydroxy-5-methylideneoxolan-2-yl)pyrimidine-2,4-dione (CAS 1365255-75-9) is a chemical compound with the molecular formula C9H9FN2O4 and a molecular weight of 228.18 g/mol. IUPAC name: 1-(3-fluoro-4-hydroxy-5-methylideneoxolan-2-yl)pyrimidine-2,4-dione. InChIKey: RTZVNXFBDOQPGR-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O4 |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | 1-(3-fluoro-4-hydroxy-5-methylideneoxolan-2-yl)pyrimidine-2,4-dione |
| InChIKey | RTZVNXFBDOQPGR-UHFFFAOYSA-N |
| SMILES | C=C1C(C(C(O1)N2C=CC(=O)NC2=O)F)O |
Computed by PubChem (NCBI)