CAS 863604-64-2 appears in our catalog under these names: 3-Fluoro-N-methoxy-N-methyl-4-nitrobenzamide, 97%, 3–Fluoro–N–methoxy–N–methyl–4–nitrobenzamide. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg, 50mg, 250mg, 1g.
3-fluoro-N-methoxy-N-methyl-4-nitrobenzamide (CAS 863604-64-2) is a chemical compound with the molecular formula C9H9FN2O4 and a molecular weight of 228.18 g/mol. IUPAC name: 3-fluoro-N-methoxy-N-methyl-4-nitrobenzamide. InChIKey: HSCCKBPILZXRSV-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O4 |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | 3-fluoro-N-methoxy-N-methyl-4-nitrobenzamide |
| InChIKey | HSCCKBPILZXRSV-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F)OC |
Computed by PubChem (NCBI)