CAS 15379-29-0 is the registry number for 2′,3′-Didehydro-2′,3′-dideoxy-5-fluorouridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-fluoro-1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione (CAS 15379-29-0) is a chemical compound with the molecular formula C9H9FN2O4 and a molecular weight of 228.18 g/mol. IUPAC name: 5-fluoro-1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione. InChIKey: SHVSSJHFEDAZCZ-CAHLUQPWSA-N.
| Molecular formula | C9H9FN2O4 |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | 5-fluoro-1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| InChIKey | SHVSSJHFEDAZCZ-CAHLUQPWSA-N |
| SMILES | C1=C[C@@H](O[C@@H]1CO)N2C=C(C(=O)NC2=O)F |
Computed by PubChem (NCBI)