CAS 2271132-92-2 is the registry number for Methyl 6-fluoro-2-(methylamino)-3-nitrobenzoate. Offered by: TRC. Available pack sizes: 250mg.
Methyl 6-fluoro-2-(methylamino)-3-nitrobenzoate (CAS 2271132-92-2) is a chemical compound with the molecular formula C9H9FN2O4 and a molecular weight of 228.18 g/mol. IUPAC name: methyl 6-fluoro-2-(methylamino)-3-nitrobenzoate. InChIKey: VYDYFHLHZGMUSD-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O4 |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | methyl 6-fluoro-2-(methylamino)-3-nitrobenzoate |
| InChIKey | VYDYFHLHZGMUSD-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1C(=O)OC)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)