CAS 1823445-36-8 is the registry number for N-(4-Fluoro-2-methoxy-5-nitrophenyl)acetamide 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
N-(4-fluoro-2-methoxy-5-nitrophenyl)acetamide (CAS 1823445-36-8) is a chemical compound with the molecular formula C9H9FN2O4 and a molecular weight of 228.18 g/mol. IUPAC name: N-(4-fluoro-2-methoxy-5-nitrophenyl)acetamide. InChIKey: LIKPHXYLNBFRHK-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O4 |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | N-(4-fluoro-2-methoxy-5-nitrophenyl)acetamide |
| InChIKey | LIKPHXYLNBFRHK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1OC)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)