Products 1564821-05-1

CAS 1564821-05-1 is the registry number for 4-(Dimethylamino)-2-fluoro-5-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(dimethylamino)-2-fluoro-5-nitrobenzoic acid (CAS 1564821-05-1) is a chemical compound with the molecular formula C9H9FN2O4 and a molecular weight of 228.18 g/mol. IUPAC name: 4-(dimethylamino)-2-fluoro-5-nitrobenzoic acid. InChIKey: WUEQHJJDPRMPAS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FN2O4
Molecular weight228.18 g/mol
IUPAC name4-(dimethylamino)-2-fluoro-5-nitrobenzoic acid
InChIKeyWUEQHJJDPRMPAS-UHFFFAOYSA-N
SMILESCN(C)C1=C(C=C(C(=C1)F)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)