cas: 1499-53-2 — see every product listed under this CAS number, including other names
Ethyl 2-benzamidoacetate, 95+%, 95+% (CAS 1499-53-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112M51-1g |
| cas | 1499-53-2 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 100g | 592.40 Pln | |
| Chemat | 500g | 1819.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-benzamidoacetate (CAS 1499-53-2) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: ethyl 2-benzamidoacetate. InChIKey: PTXRQIPIELXJFH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | ethyl 2-benzamidoacetate |
| InChIKey | PTXRQIPIELXJFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)