cas: 1499-53-2 — see every product listed under this CAS number, including other names
Ethyl Hippurate, >98.0%(HPLC) (CAS 1499-53-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E1473-5G |
| cas | 1499-53-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 216.69 Pln | |
| TCI | 25g | 924.77 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
Ethyl 2-benzamidoacetate (CAS 1499-53-2) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: ethyl 2-benzamidoacetate. InChIKey: PTXRQIPIELXJFH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | ethyl 2-benzamidoacetate |
| InChIKey | PTXRQIPIELXJFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)