Ethyl 2-bromo-5-nitrobenzoate, 98%
cas: 208176-31-2 — see every product listed under this CAS number, including other names
Ethyl 2-bromo-5-nitrobenzoate, 98% (CAS 208176-31-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A221028-1g |
| cas | 208176-31-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 314.75 Pln | |
| Ambeed | 10g | 548.38 Pln | |
| Ambeed | 25g | 998.94 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 381.20 Pln | |
| BLDpharm | 1g | 147.75 Pln | |
| BLDpharm | 5g | 331.02 Pln | |
| BLDpharm | 25g | 1075.20 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 695.61 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-bromo-5-nitrobenzoate (CAS 208176-31-2) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: ethyl 2-bromo-5-nitrobenzoate. InChIKey: YCHNRCVNPZZVED-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | ethyl 2-bromo-5-nitrobenzoate |
| InChIKey | YCHNRCVNPZZVED-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)