CAS 857895-53-5 is the registry number for Ethyl 5-bromo-2-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
Ethyl 5-bromo-2-nitrobenzoate (CAS 857895-53-5) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: ethyl 5-bromo-2-nitrobenzoate. InChIKey: PMUKXBWMOBHXHK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | ethyl 5-bromo-2-nitrobenzoate |
| InChIKey | PMUKXBWMOBHXHK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)