Products 857895-53-5

CAS 857895-53-5 is the registry number for Ethyl 5-bromo-2-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-2-nitrobenzoate (CAS 857895-53-5) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: ethyl 5-bromo-2-nitrobenzoate. InChIKey: PMUKXBWMOBHXHK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrNO4
Molecular weight274.07 g/mol
IUPAC nameethyl 5-bromo-2-nitrobenzoate
InChIKeyPMUKXBWMOBHXHK-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=CC(=C1)Br)[N+](=O)[O-]

Computed by PubChem (NCBI)