Products 146884-05-1
CAS 146884-05-1 is the registry number for 3-(3-Bromo-4-hydroxyphenyl)-2-(hydroxyimino)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoic acid (CAS 146884-05-1) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: 3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoic acid. InChIKey: OTQJUBTXGZWKKA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | 3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoic acid |
| InChIKey | OTQJUBTXGZWKKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=NO)C(=O)O)Br)O |
Computed by PubChem (NCBI)