CAS 31706-23-7 appears in our catalog under these names: Ethyl 2-bromo-3-nitrobenzoate, 95%, Ethyl 2-bromo-3-nitrobenzoate, 98%, Ethyl 2–bromo–3–nitrobenzoate, Ethyl 2-bromo-3-nitrobenzoate, 97%+(GC-MS),RG, 97%+(GC-MS),RG, Ethyl 2-bromo-3-nitrobenzoate, 97%+(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
Ethyl 2-bromo-3-nitrobenzoate (CAS 31706-23-7) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: ethyl 2-bromo-3-nitrobenzoate. InChIKey: WTNZOABLVURCTP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | ethyl 2-bromo-3-nitrobenzoate |
| InChIKey | WTNZOABLVURCTP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)