Products 1804405-87-5
CAS 1804405-87-5 appears in our catalog under these names: 3-Bromo-2-methyl-4-nitro-benzoic acid methyl ester, 95%, Methyl 3-bromo-2-methyl-4-nitrobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Methyl 3-bromo-2-methyl-4-nitrobenzoate (CAS 1804405-87-5) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: methyl 3-bromo-2-methyl-4-nitrobenzoate. InChIKey: LOYNLWOSZNXFCN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | methyl 3-bromo-2-methyl-4-nitrobenzoate |
| InChIKey | LOYNLWOSZNXFCN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Br)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)