CAS 65447-49-6 is the registry number for 2-Bromo-1-(4-methoxy-3-nitrophenyl)-1-ethanone, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-bromo-1-(4-methoxy-3-nitrophenyl)ethanone (CAS 65447-49-6) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: 2-bromo-1-(4-methoxy-3-nitrophenyl)ethanone. InChIKey: CVPDMBUSCIDXCM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | 2-bromo-1-(4-methoxy-3-nitrophenyl)ethanone |
| InChIKey | CVPDMBUSCIDXCM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)