Products 1565748-29-9
CAS 1565748-29-9 appears in our catalog under these names: 2-(2-Bromo-4-nitrophenyl)propanoic acid, 98%, 2-(2-Bromo-4-nitrophenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
2-(2-bromo-4-nitrophenyl)propanoic acid (CAS 1565748-29-9) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: 2-(2-bromo-4-nitrophenyl)propanoic acid. InChIKey: ALIKWVGXDKSWQO-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | 2-(2-bromo-4-nitrophenyl)propanoic acid |
| InChIKey | ALIKWVGXDKSWQO-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)