cas: 52460-86-3 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-2,2-diphenylacetate, 95+% (CAS 52460-86-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A798351-10g |
| cas | 52460-86-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13780.06 Pln | |
| AmBeed | 5g | 9210.04 Pln | |
| AmBeed | 25g | 26728.45 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 2-chloro-2,2-diphenylacetate (CAS 52460-86-3) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: ethyl 2-chloro-2,2-diphenylacetate. InChIKey: MSBGLMWCKRSNHW-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO2 |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | ethyl 2-chloro-2,2-diphenylacetate |
| InChIKey | MSBGLMWCKRSNHW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)