Products 1820712-70-6
CAS 1820712-70-6 is the registry number for methyl 2-chloro-4-(3,5-dimethylphenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-chloro-4-(3,5-dimethylphenyl)benzoate (CAS 1820712-70-6) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: methyl 2-chloro-4-(3,5-dimethylphenyl)benzoate. InChIKey: OVYBXXHNIITVBC-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO2 |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | methyl 2-chloro-4-(3,5-dimethylphenyl)benzoate |
| InChIKey | OVYBXXHNIITVBC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC(=C(C=C2)C(=O)OC)Cl)C |
Computed by PubChem (NCBI)