CAS 52460-86-3 appears in our catalog under these names: Ethyl chloro(diphenyl)acetate, 95%, Ethyl 2-chloro-2,2-diphenylacetate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
Ethyl 2-chloro-2,2-diphenylacetate (CAS 52460-86-3) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: ethyl 2-chloro-2,2-diphenylacetate. InChIKey: MSBGLMWCKRSNHW-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO2 |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | ethyl 2-chloro-2,2-diphenylacetate |
| InChIKey | MSBGLMWCKRSNHW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)