CAS 1427027-26-6 is the registry number for 2-((2-Chlorobenzyl)oxy)-3,4-dimethylbenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-chlorophenyl)methoxy]-3,4-dimethylbenzaldehyde (CAS 1427027-26-6) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: 2-[(2-chlorophenyl)methoxy]-3,4-dimethylbenzaldehyde. InChIKey: QEIZRARZTZIVFN-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO2 |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methoxy]-3,4-dimethylbenzaldehyde |
| InChIKey | QEIZRARZTZIVFN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C=O)OCC2=CC=CC=C2Cl)C |
Computed by PubChem (NCBI)