Products 1160257-70-4

CAS 1160257-70-4 is the registry number for 2-(Biphenyl-4-yloxy)butanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-phenylphenoxy)butanoyl chloride (CAS 1160257-70-4) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: 2-(4-phenylphenoxy)butanoyl chloride. InChIKey: DPIJNYBOYLZOCI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15ClO2
Molecular weight274.74 g/mol
IUPAC name2-(4-phenylphenoxy)butanoyl chloride
InChIKeyDPIJNYBOYLZOCI-UHFFFAOYSA-N
SMILESCCC(C(=O)Cl)OC1=CC=C(C=C1)C2=CC=CC=C2

Computed by PubChem (NCBI)