Products 19561-95-6
CAS 19561-95-6 is the registry number for 1-(4-(2-Chloroethoxy)phenyl)-2-phenylethanone, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg.
1-[4-(2-chloroethoxy)phenyl]-2-phenylethanone (CAS 19561-95-6) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: 1-[4-(2-chloroethoxy)phenyl]-2-phenylethanone. InChIKey: SJMPWHDFSKHYRD-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO2 |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | 1-[4-(2-chloroethoxy)phenyl]-2-phenylethanone |
| InChIKey | SJMPWHDFSKHYRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC=C(C=C2)OCCCl |
Computed by PubChem (NCBI)