CAS 111000-54-5 appears in our catalog under these names: Propiophenone Impurity 2, 1-(4-(Benzyloxy)phenyl)-2-chloropropan-1-one. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 750mg, 500mg.
2-chloro-1-(4-phenylmethoxyphenyl)propan-1-one (CAS 111000-54-5) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: 2-chloro-1-(4-phenylmethoxyphenyl)propan-1-one. InChIKey: KABSWBAVVVOZDJ-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO2 |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | 2-chloro-1-(4-phenylmethoxyphenyl)propan-1-one |
| InChIKey | KABSWBAVVVOZDJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)OCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)