cas: 1214375-85-5 — see every product listed under this CAS number, including other names
Ethyl 3,6-dibromopicolinate, 96%, 96% (CAS 1214375-85-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125X1-100mg |
| cas | 1214375-85-5 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 10g | 1077.20 Pln | |
| Chemat | 25g | 2094.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3,6-dibromopyridine-2-carboxylate (CAS 1214375-85-5) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 3,6-dibromopyridine-2-carboxylate. InChIKey: FIFJOCLGVVDZFW-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 3,6-dibromopyridine-2-carboxylate |
| InChIKey | FIFJOCLGVVDZFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=N1)Br)Br |
Computed by PubChem (NCBI)