CAS 1266340-00-4 is the registry number for Ethyl 3-formyl-4-nitrobenzoate, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Ethyl 3-formyl-4-nitrobenzoate (CAS 1266340-00-4) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: ethyl 3-formyl-4-nitrobenzoate. InChIKey: QGJNZARLLQNXMC-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | ethyl 3-formyl-4-nitrobenzoate |
| InChIKey | QGJNZARLLQNXMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)