Products 67081-70-3
CAS 67081-70-3 appears in our catalog under these names: 2-Acetamidobenzene-1,3-dicarboxylic acid, 95%, 2-Acetamidoisophthalic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-acetamidobenzene-1,3-dicarboxylic acid (CAS 67081-70-3) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 2-acetamidobenzene-1,3-dicarboxylic acid. InChIKey: KAHYQMPCKOTUFX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 2-acetamidobenzene-1,3-dicarboxylic acid |
| InChIKey | KAHYQMPCKOTUFX-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)