Products 383177-50-2
CAS 383177-50-2 appears in our catalog under these names: Beta-(4-pyridyl)acrolein oxalate, 97%, β–(4–Pyridyl)acrolein Oxalate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
Oxalic acid;(E)-3-pyridin-4-ylprop-2-enal (CAS 383177-50-2) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: oxalic acid;(E)-3-pyridin-4-ylprop-2-enal. InChIKey: NSTHNVMITOXEJZ-TYYBGVCCSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | oxalic acid;(E)-3-pyridin-4-ylprop-2-enal |
| InChIKey | NSTHNVMITOXEJZ-TYYBGVCCSA-N |
| SMILES | C1=CN=CC=C1/C=C/C=O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)