CAS 220616-66-0 appears in our catalog under these names: 4-(Allyloxy)pyridine-2,6-dicarboxylic acid, 98%, 4-(Allyloxy)pyridine-2,6-dicarboxylic acid, 98%, 98%. Offered by: Chemat Brand, Chemat, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 50mg.
4-prop-2-enoxypyridine-2,6-dicarboxylic acid (CAS 220616-66-0) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 4-prop-2-enoxypyridine-2,6-dicarboxylic acid. InChIKey: FROYMHAREMUSNB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 4-prop-2-enoxypyridine-2,6-dicarboxylic acid |
| InChIKey | FROYMHAREMUSNB-UHFFFAOYSA-N |
| SMILES | C=CCOC1=CC(=NC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)