CAS 893781-87-8 is the registry number for [(3-Oxo-3,4-dihydro-2H-1,4-benzoxazin-6-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetic acid (CAS 893781-87-8) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetic acid. InChIKey: CYFACMGWBVUPKX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetic acid |
| InChIKey | CYFACMGWBVUPKX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)OCC(=O)O |
Computed by PubChem (NCBI)