CAS 106268-95-5 is the registry number for (R)-(-)-Glycidyl-4-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[(2R)-oxiran-2-yl]methyl 4-nitrobenzoate (CAS 106268-95-5) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: [(2R)-oxiran-2-yl]methyl 4-nitrobenzoate. InChIKey: MUWIANZPEBMVHH-SECBINFHSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | [(2R)-oxiran-2-yl]methyl 4-nitrobenzoate |
| InChIKey | MUWIANZPEBMVHH-SECBINFHSA-N |
| SMILES | C1[C@@H](O1)COC(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)