CAS 842137-45-5 is the registry number for 2,2-Dimethyl-6-nitro-4H-benzo[d][1,3]dioxin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-6-nitro-1,3-benzodioxin-4-one (CAS 842137-45-5) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 2,2-dimethyl-6-nitro-1,3-benzodioxin-4-one. InChIKey: BNQYKJNRIMDSEN-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 2,2-dimethyl-6-nitro-1,3-benzodioxin-4-one |
| InChIKey | BNQYKJNRIMDSEN-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O1)C |
Computed by PubChem (NCBI)