cas: 6283-81-4 — see every product listed under this CAS number, including other names
Ethyl 3-oxo-3-(pyridin-3-yl)propanoate 97% (CAS 6283-81-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130026-250mg |
| cas | 6283-81-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 542.81 Pln | |
| Ambeed | 25g | 1010.06 Pln | |
| Ambeed | 100g | 3107.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A130026 |
Ethyl 3-oxo-3-pyridin-3-ylpropanoate (CAS 6283-81-4) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: ethyl 3-oxo-3-pyridin-3-ylpropanoate. InChIKey: APQGYFNHIWMRIJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | ethyl 3-oxo-3-pyridin-3-ylpropanoate |
| InChIKey | APQGYFNHIWMRIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)