cas: 6283-81-4 — see every product listed under this CAS number, including other names
Ethyl 3-oxo-3-(pyridin-3-yl)propanoate, 98%, 98% (CAS 6283-81-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAT7-100mg |
| cas | 6283-81-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 448.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-oxo-3-pyridin-3-ylpropanoate (CAS 6283-81-4) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: ethyl 3-oxo-3-pyridin-3-ylpropanoate. InChIKey: APQGYFNHIWMRIJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | ethyl 3-oxo-3-pyridin-3-ylpropanoate |
| InChIKey | APQGYFNHIWMRIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)