Ethyl 4-acetyl-5-oxohexanoate, 98%
cas: 2832-10-2 — see every product listed under this CAS number, including other names
Ethyl 4-acetyl-5-oxohexanoate, 98% (CAS 2832-10-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 50g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A412801-1g |
| cas | 2832-10-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 676.31 Pln | |
| Ambeed | 100g | 2078.06 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 242.16 Pln | |
| BLDpharm | 25g | 725.32 Pln | |
| BLDpharm | 100g | 2235.90 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 261.20 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 100g | 1638.80 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 393.63 Pln | |
| Fluorochem | 25g | 664.37 Pln | |
| Fluorochem | 50g | 888.25 Pln | |
| Fluorochem | 100g | 1700.46 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 4-acetyl-5-oxohexanoate (CAS 2832-10-2) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl 4-acetyl-5-oxohexanoate. InChIKey: YRSGDLIATOURQO-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | ethyl 4-acetyl-5-oxohexanoate |
| InChIKey | YRSGDLIATOURQO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(C(=O)C)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Hexanoic acid, 4-acetyl-5-oxo-, ethyl ester, Ethyl 4-acetyl-5-oxohexanoate, 4-Acetyl-5-oxohexanoic Acid Ethyl Ester, Hexanoic acid,4-acetyl-5-oxo-, ethyl ester, 4,4-Diacetylbutyric Acid Ethyl Ester, Ethyl 4,4-Diacetylbutyrate, bromhexinehydrochloride, Ethyl 4-acetyl-5-oxo-hexanoate, YRSGDLIATOURQO-UHFFFAOYSA-N, 4-Acetyl-5-oxohexanoic Acid Ethyl