Ethyl 4-amino-3-hydroxybenzoate, 95%
cas: 87081-52-5 — see every product listed under this CAS number, including other names
Ethyl 4-amino-3-hydroxybenzoate, 95% (CAS 87081-52-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QI-9061-1g |
| cas | 87081-52-5 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 937.75 Pln | |
| Ambeed | 10g | 1460.62 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 1034.00 Pln | |
| Chemat | 10g | 1614.80 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 264.38 Pln | |
| BLDpharm | 5g | 1003.00 Pln | |
| BLDpharm | 10g | 1569.47 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 492.55 Pln | |
| Fluorochem | 5g | 1913.93 Pln | |
| Fluorochem | 10g | 3007.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Ethyl 4-amino-3-hydroxybenzoate (CAS 87081-52-5) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: ethyl 4-amino-3-hydroxybenzoate. InChIKey: SVLMEEHRAATUJY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | ethyl 4-amino-3-hydroxybenzoate |
| InChIKey | SVLMEEHRAATUJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)O |
Computed by PubChem (NCBI)