CAS 168473-87-8 appears in our catalog under these names: Ethyl 4–bromo–3–nitrobenzoate, Ethyl 4-bromo-3-nitrobenzoate, 97%, 97%, Ethyl 4-bromo-3-nitrobenzoate, 98%, Ethyl 4-bromo-3-nitrobenzoate, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g.
Ethyl 4-bromo-3-nitrobenzoate (CAS 168473-87-8) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: ethyl 4-bromo-3-nitrobenzoate. InChIKey: HWABKOBGQZQMAL-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | ethyl 4-bromo-3-nitrobenzoate |
| InChIKey | HWABKOBGQZQMAL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)