cas: 879093-03-5 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-2,5-difluorobenzoate, 97% (CAS 879093-03-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A629334-10g |
| cas | 879093-03-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13187.65 Pln | |
| AmBeed | 5g | 7771.33 Pln | |
| AmBeed | 25g | 25882.15 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 4-chloro-2,5-difluorobenzoate (CAS 879093-03-5) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: ethyl 4-chloro-2,5-difluorobenzoate. InChIKey: RWNQCUICDKYYNJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | ethyl 4-chloro-2,5-difluorobenzoate |
| InChIKey | RWNQCUICDKYYNJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1F)Cl)F |
Computed by PubChem (NCBI)