cas: 773139-38-1 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-2,6-difluorobenzoate, 95%, 95% (CAS 773139-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ICU2-100mg |
| cas | 773139-38-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-chloro-2,6-difluorobenzoate (CAS 773139-38-1) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: ethyl 4-chloro-2,6-difluorobenzoate. InChIKey: XYUKGBLOCAJQMA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | ethyl 4-chloro-2,6-difluorobenzoate |
| InChIKey | XYUKGBLOCAJQMA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1F)Cl)F |
Computed by PubChem (NCBI)