CAS 175276-52-5 appears in our catalog under these names: 4-Formyl-2,5-dimethyl-1-phenyl-1H-pyrrole-3-carboxylic acid ethyl ester, Ethyl 4-formyl-2,5-dimethyl-1-phenyl-1H-pyrrole-3-carboxylate, 97% . Offered by: Biosynth, Thermo Scientific. Available pack sizes: 10g, 1g, 5g.
Ethyl 4-formyl-2,5-dimethyl-1-phenylpyrrole-3-carboxylate (CAS 175276-52-5) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: ethyl 4-formyl-2,5-dimethyl-1-phenylpyrrole-3-carboxylate. InChIKey: BGDYIZGTPVRWAM-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | ethyl 4-formyl-2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
| InChIKey | BGDYIZGTPVRWAM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C1C=O)C)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)